l> 1-Chloro-1-phenylethane - 672-65-1 - catalog of chemical Suppliers
Visit our website come find much more information favor suppliers, MSDS, infra-red (IR), nuclear magnetic resonance spectra (NMR), bp, mp, nd20, molecule formula (MF), molfile, sdf file, structure, 3d model. Friend will likewise find info like safety, risk, hazard and MSDS.This database is a catalog of end 1500000 chemicals and also over 1000 chemical suppliers. If you room a providers you may also add your own magazine of chemicals for free.
| Enter a name, molecular formula, cas number or SMILES | | more info |
Find chemicals. | | | Search by structureAdvanced Search |
Predict NMR spectrum | | MF: |
MW: |
bp (°C): |
density: |
nd: |
InChI:1S/C8H9Cl/c1-7(9)8-5-3-2-4-6-8/h2-7H,1H3 InChIKey:GTLWADFFABIGAE-UHFFFAOYSA-N | | H donor:0 H acceptor:0 | Rotatable bond:1 | Stereocenter:1 |
| cLogP:3.638 cLogS:-2.511 | Polar surface:0 | NEW: 3D model: present | |
Permanent link: http://www.couchsurfingcook.com/search/cas/672651.html | Report error(s) |
Click on a product surname to get more information on the compound, top top a supplier surname to get much more information on the supplier. |
Supplier | Description | Reference |
capotchem | (1-Chloroethyl)benzene, 98% (Min,GC) | | | on request |
atomole | | , 98.0% | |
frinton | (1-chloroethyl)benzene1-chloro-1-phenylethane | | | |
atomax | | | |
chempur | (1-Chloroethyl)benzene/ 95% | | 25 ml | | | and various other units | |
advtechind | (1-chloroethyl)benzene 97+% | |
finetechnology-ind | | , 98% | |
alfa-chemistry | 1-chloroethylbenzene, 98% | |
chemieliva | (1-Chloroethyl)benzene, 98% | |
AcrosOrganics | 1-Chloro-1-phenylethane, 97% Infrared 3D version | \n | \nXI: | \nIrritant |
\n");" onclick="stopPropagation(event);">Hazard Risk security MSDS (en) MSDS (de) MSDS (fr)
327061000 | 100 GR | | 327061000 | 100 GR | | 327061000 | 100 GR | | 327061000 | 100 GR | | 327061000 | 100 GR | | hairuichem | (1-Chloroethyl)benzene, 98%NLT | |
chinadayangchem | (1-Chloroethyl)-benzene | |
etachem | (1-Chloroethyl)benzene | |
keyorganics | | , 97% | |
carbonesci | 1-Phenyl-ethylchloride, 98% | |
leapchem | (1-chloroethyl)benzene | |
cm-finechemicals | | | |
matrixscientific | | | |
molcore | (1-Chloroethyl)benzene, NLT 98% | |
apollo | alpha-Methylbenzyl chloride | , 0.97 | 3D design |